C31H28ClN3O8 — CID 25033285
(5S,5aS,8aR,9R)-5-[4-[(4-chlorophenoxy)methyl]triazol-1-yl]-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-8-one (PubChem CID 25033285) has the molecular formula C31H28ClN3O8 and a molecular weight of 606.03 g/mol. Its IUPAC name is (5S,5aS,8aR,9R)-5-[4-[(4-chlorophenoxy)methyl]triazol-1-yl]-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-8-one.
| Compound Name | (5S,5aS,8aR,9R)-5-[4-[(4-chlorophenoxy)methyl]triazol-1-yl]-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-8-one |
|---|---|
| PubChem CID | 25033285 |
| Molecular Formula | C31H28ClN3O8 |
| Molecular Weight | 606.03 g/mol |
| Exact Mass | 605.16 |
| IUPAC Name | (5S,5aS,8aR,9R)-5-[4-[(4-chlorophenoxy)methyl]triazol-1-yl]-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-8-one |
| SMILES | COc1cc([C@@H]2c3cc4c(cc3[C@@H](n3cc(COc5ccc(Cl)cc5)nn3)[C@H]3COC(=O)[C@H]23)OCO4)cc(OC)c1OC |
| InChI | InChI=1S/C31H28ClN3O8/c1-37-25-8-16(9-26(38-2)30(25)39-3)27-20-10-23-24(43-15-42-23)11-21(20)29(22-14-41-31(36)28(22)27)35-12-18(33-34-35)13-40-19-6-4-17(32)5-7-19/h4-12,22,27-29H,13-15H2,1-3H3/t22-,27+,28-,29+/m0/s1 |
| InChIKey | HZZRUGZTIRSBIM-ALMBTRMVSA-N |
| XLogP | 4.79 |
| TPSA | 112.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.03 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |