C31H27ClN4O8 — CID 130428814
N-[(5S,5aS,8aR,9R)-8-oxo-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl]-1-(4-chlorophenyl)triazole-4-carboxamide (PubChem CID 130428814) has the molecular formula C31H27ClN4O8 and a molecular weight of 619.03 g/mol. Its IUPAC name is N-[(5S,5aS,8aR,9R)-8-oxo-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl]-1-(4-chlorophenyl)triazole-4-carboxamide.
| Compound Name | N-[(5S,5aS,8aR,9R)-8-oxo-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl]-1-(4-chlorophenyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 130428814 |
| Molecular Formula | C31H27ClN4O8 |
| Molecular Weight | 619.03 g/mol |
| Exact Mass | 618.15 |
| IUPAC Name | N-[(5S,5aS,8aR,9R)-8-oxo-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl]-1-(4-chlorophenyl)triazole-4-carboxamide |
| SMILES | COc1cc([C@@H]2c3cc4c(cc3[C@@H](NC(=O)c3cn(-c5ccc(Cl)cc5)nn3)[C@H]3COC(=O)[C@H]23)OCO4)cc(OC)c1OC |
| InChI | InChI=1S/C31H27ClN4O8/c1-39-24-8-15(9-25(40-2)29(24)41-3)26-18-10-22-23(44-14-43-22)11-19(18)28(20-13-42-31(38)27(20)26)33-30(37)21-12-36(35-34-21)17-6-4-16(32)5-7-17/h4-12,20,26-28H,13-14H2,1-3H3,(H,33,37)/t20-,26+,27-,28+/m0/s1 |
| InChIKey | QUKDJVQRQSRGMQ-PCULNXKLSA-N |
| XLogP | 4.08 |
| TPSA | 132.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.03 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |