C33H32N4O10 — CID 130428473
N-[(5S,5aS,8aR,9R)-8-oxo-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl]-1-(3,5-dimethoxyphenyl)triazole-4-carboxamide (PubChem CID 130428473) has the molecular formula C33H32N4O10 and a molecular weight of 644.64 g/mol. Its IUPAC name is N-[(5S,5aS,8aR,9R)-8-oxo-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl]-1-(3,5-dimethoxyphenyl)triazole-4-carboxamide.
| Compound Name | N-[(5S,5aS,8aR,9R)-8-oxo-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl]-1-(3,5-dimethoxyphenyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 130428473 |
| Molecular Formula | C33H32N4O10 |
| Molecular Weight | 644.64 g/mol |
| Exact Mass | 644.21 |
| IUPAC Name | N-[(5S,5aS,8aR,9R)-8-oxo-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl]-1-(3,5-dimethoxyphenyl)triazole-4-carboxamide |
| SMILES | COc1cc(OC)cc(-n2cc(C(=O)N[C@@H]3c4cc5c(cc4[C@@H](c4cc(OC)c(OC)c(OC)c4)[C@H]4C(=O)OC[C@@H]43)OCO5)nn2)c1 |
| InChI | InChI=1S/C33H32N4O10/c1-40-18-8-17(9-19(10-18)41-2)37-13-23(35-36-37)32(38)34-30-21-12-25-24(46-15-47-25)11-20(21)28(29-22(30)14-45-33(29)39)16-6-26(42-3)31(44-5)27(7-16)43-4/h6-13,22,28-30H,14-15H2,1-5H3,(H,34,38)/t22-,28+,29-,30+/m0/s1 |
| InChIKey | HEUGJEZRRLXYGO-GEYQZXRLSA-N |
| XLogP | 3.44 |
| TPSA | 150.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.64 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |