C20H21ClN4O7S — CID 2503371
N-(2-chloro-5-nitrophenyl)-2-[4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperazin-1-yl]acetamide (PubChem CID 2503371) has the molecular formula C20H21ClN4O7S and a molecular weight of 496.93 g/mol. Its IUPAC name is N-(2-chloro-5-nitrophenyl)-2-[4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperazin-1-yl]acetamide.
| Compound Name | N-(2-chloro-5-nitrophenyl)-2-[4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 2503371 |
| Molecular Formula | C20H21ClN4O7S |
| Molecular Weight | 496.93 g/mol |
| Exact Mass | 496.08 |
| IUPAC Name | N-(2-chloro-5-nitrophenyl)-2-[4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperazin-1-yl]acetamide |
| SMILES | O=C(CN1CCN(S(=O)(=O)c2ccc3c(c2)OCCO3)CC1)Nc1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C20H21ClN4O7S/c21-16-3-1-14(25(27)28)11-17(16)22-20(26)13-23-5-7-24(8-6-23)33(29,30)15-2-4-18-19(12-15)32-10-9-31-18/h1-4,11-12H,5-10,13H2,(H,22,26) |
| InChIKey | FLXGPAMTRHXRGD-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 131.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.93 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|