C23H29NO6 — CID 25034292
diethyl 4-(2-ethoxy-2-oxoethyl)-2,6-dimethyl-1-phenyl-4H-pyridine-3,5-dicarboxylate (PubChem CID 25034292) has the molecular formula C23H29NO6 and a molecular weight of 415.49 g/mol. Its IUPAC name is diethyl 4-(2-ethoxy-2-oxoethyl)-2,6-dimethyl-1-phenyl-4H-pyridine-3,5-dicarboxylate.
| Compound Name | diethyl 4-(2-ethoxy-2-oxoethyl)-2,6-dimethyl-1-phenyl-4H-pyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 25034292 |
| Molecular Formula | C23H29NO6 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | diethyl 4-(2-ethoxy-2-oxoethyl)-2,6-dimethyl-1-phenyl-4H-pyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)CC1C(C(=O)OCC)=C(C)N(c2ccccc2)C(C)=C1C(=O)OCC |
| InChI | InChI=1S/C23H29NO6/c1-6-28-19(25)14-18-20(22(26)29-7-2)15(4)24(17-12-10-9-11-13-17)16(5)21(18)23(27)30-8-3/h9-13,18H,6-8,14H2,1-5H3 |
| InChIKey | BMQUZBBXDAQTNI-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|