C16H20N4O4S2 — CID 25034831
N-[4-(acetylsulfamoyl)phenyl]-2-(1-methylimidazol-2-yl)sulfanylbutanamide (PubChem CID 25034831) has the molecular formula C16H20N4O4S2 and a molecular weight of 396.49 g/mol. Its IUPAC name is N-[4-(acetylsulfamoyl)phenyl]-2-(1-methylimidazol-2-yl)sulfanylbutanamide.
| Compound Name | N-[4-(acetylsulfamoyl)phenyl]-2-(1-methylimidazol-2-yl)sulfanylbutanamide |
|---|---|
| PubChem CID | 25034831 |
| Molecular Formula | C16H20N4O4S2 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | N-[4-(acetylsulfamoyl)phenyl]-2-(1-methylimidazol-2-yl)sulfanylbutanamide |
| SMILES | CCC(Sc1nccn1C)C(=O)Nc1ccc(S(=O)(=O)NC(C)=O)cc1 |
| InChI | InChI=1S/C16H20N4O4S2/c1-4-14(25-16-17-9-10-20(16)3)15(22)18-12-5-7-13(8-6-12)26(23,24)19-11(2)21/h5-10,14H,4H2,1-3H3,(H,18,22)(H,19,21) |
| InChIKey | GZUMJZJEACGXGX-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |