C26H24N4O7S — CID 25036861
(4-nitrophenyl)methyl 5-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)sulfamoyl]-2-methylbenzoate (PubChem CID 25036861) has the molecular formula C26H24N4O7S and a molecular weight of 536.57 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 5-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)sulfamoyl]-2-methylbenzoate.
| Compound Name | (4-nitrophenyl)methyl 5-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)sulfamoyl]-2-methylbenzoate |
|---|---|
| PubChem CID | 25036861 |
| Molecular Formula | C26H24N4O7S |
| Molecular Weight | 536.57 g/mol |
| Exact Mass | 536.14 |
| IUPAC Name | (4-nitrophenyl)methyl 5-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)sulfamoyl]-2-methylbenzoate |
| SMILES | Cc1ccc(S(=O)(=O)Nc2c(C)n(C)n(-c3ccccc3)c2=O)cc1C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H24N4O7S/c1-17-9-14-22(15-23(17)26(32)37-16-19-10-12-21(13-11-19)30(33)34)38(35,36)27-24-18(2)28(3)29(25(24)31)20-7-5-4-6-8-20/h4-15,27H,16H2,1-3H3 |
| InChIKey | FGVAVGJUCNPZRA-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 142.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.57 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|