C21H17Cl2NO5S — CID 25036938
(3,4-dichlorophenyl)methyl 5-(benzylsulfamoyl)-2-hydroxybenzoate (PubChem CID 25036938) has the molecular formula C21H17Cl2NO5S and a molecular weight of 466.34 g/mol. Its IUPAC name is (3,4-dichlorophenyl)methyl 5-(benzylsulfamoyl)-2-hydroxybenzoate.
| Compound Name | (3,4-dichlorophenyl)methyl 5-(benzylsulfamoyl)-2-hydroxybenzoate |
|---|---|
| PubChem CID | 25036938 |
| Molecular Formula | C21H17Cl2NO5S |
| Molecular Weight | 466.34 g/mol |
| Exact Mass | 465.02 |
| IUPAC Name | (3,4-dichlorophenyl)methyl 5-(benzylsulfamoyl)-2-hydroxybenzoate |
| SMILES | O=C(OCc1ccc(Cl)c(Cl)c1)c1cc(S(=O)(=O)NCc2ccccc2)ccc1O |
| InChI | InChI=1S/C21H17Cl2NO5S/c22-18-8-6-15(10-19(18)23)13-29-21(26)17-11-16(7-9-20(17)25)30(27,28)24-12-14-4-2-1-3-5-14/h1-11,24-25H,12-13H2 |
| InChIKey | AEHDUIIOBRWPMP-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.34 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |