C28H29NO6S — CID 25036126
[2-(4-cyclohexylphenyl)-2-oxoethyl] 5-(benzylsulfamoyl)-2-hydroxybenzoate (PubChem CID 25036126) has the molecular formula C28H29NO6S and a molecular weight of 507.61 g/mol. Its IUPAC name is [2-(4-cyclohexylphenyl)-2-oxoethyl] 5-(benzylsulfamoyl)-2-hydroxybenzoate.
| Compound Name | [2-(4-cyclohexylphenyl)-2-oxoethyl] 5-(benzylsulfamoyl)-2-hydroxybenzoate |
|---|---|
| PubChem CID | 25036126 |
| Molecular Formula | C28H29NO6S |
| Molecular Weight | 507.61 g/mol |
| Exact Mass | 507.17 |
| IUPAC Name | [2-(4-cyclohexylphenyl)-2-oxoethyl] 5-(benzylsulfamoyl)-2-hydroxybenzoate |
| SMILES | O=C(COC(=O)c1cc(S(=O)(=O)NCc2ccccc2)ccc1O)c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C28H29NO6S/c30-26-16-15-24(36(33,34)29-18-20-7-3-1-4-8-20)17-25(26)28(32)35-19-27(31)23-13-11-22(12-14-23)21-9-5-2-6-10-21/h1,3-4,7-8,11-17,21,29-30H,2,5-6,9-10,18-19H2 |
| InChIKey | KDEFDHZZSGAFCP-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.61 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |