C21H20ClN5O5S — CID 25038111
[1-[4-[(4-methylpyrimidin-2-yl)sulfamoyl]anilino]-1-oxobutan-2-yl] 2-chloropyridine-3-carboxylate (PubChem CID 25038111) has the molecular formula C21H20ClN5O5S and a molecular weight of 489.94 g/mol. Its IUPAC name is [1-[4-[(4-methylpyrimidin-2-yl)sulfamoyl]anilino]-1-oxobutan-2-yl] 2-chloropyridine-3-carboxylate.
| Compound Name | [1-[4-[(4-methylpyrimidin-2-yl)sulfamoyl]anilino]-1-oxobutan-2-yl] 2-chloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 25038111 |
| Molecular Formula | C21H20ClN5O5S |
| Molecular Weight | 489.94 g/mol |
| Exact Mass | 489.09 |
| IUPAC Name | [1-[4-[(4-methylpyrimidin-2-yl)sulfamoyl]anilino]-1-oxobutan-2-yl] 2-chloropyridine-3-carboxylate |
| SMILES | CCC(OC(=O)c1cccnc1Cl)C(=O)Nc1ccc(S(=O)(=O)Nc2nccc(C)n2)cc1 |
| InChI | InChI=1S/C21H20ClN5O5S/c1-3-17(32-20(29)16-5-4-11-23-18(16)22)19(28)26-14-6-8-15(9-7-14)33(30,31)27-21-24-12-10-13(2)25-21/h4-12,17H,3H2,1-2H3,(H,26,28)(H,24,25,27) |
| InChIKey | OLQNSVXOIYZLFT-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 140.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.94 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|