About 2-methoxyethylimino-[(Z)-2-methyl-3-phenylprop-2-enyl]-oxo-phenyl-λ6-sulfane
2-methoxyethylimino-[(Z)-2-methyl-3-phenylprop-2-enyl]-oxo-phenyl-λ6-sulfane (PubChem CID 25038835) has the molecular formula C19H23NO2S
and a molecular weight of 329.47 g/mol. Its IUPAC name is 2-methoxyethylimino-[(Z)-2-methyl-3-phenylprop-2-enyl]-oxo-phenyl-λ6-sulfane.
Molecular Properties
| Compound Name | 2-methoxyethylimino-[(Z)-2-methyl-3-phenylprop-2-enyl]-oxo-phenyl-λ6-sulfane |
| PubChem CID | 25038835 |
| Molecular Formula | C19H23NO2S |
| Molecular Weight | 329.47 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 2-methoxyethylimino-[(Z)-2-methyl-3-phenylprop-2-enyl]-oxo-phenyl-λ6-sulfane |
| SMILES | COCCN=[S@](=O)(C/C(C)=C\c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H23NO2S/c1-17(15-18-9-5-3-6-10-18)16-23(21,20-13-14-22-2)19-11-7-4-8-12-19/h3-12,15H,13-14,16H2,1-2H3/b17-15-/t23-/m0/s1 |
| InChIKey | QGUPJPRDARULNS-ZBORUMQWSA-N |
| XLogP | 4.26 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.47 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxyethylimino-[(Z)-2-methyl-3-phenylprop-2-enyl]-oxo-phenyl-λ6-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxyethylimino-[(Z)-2-methyl-3-phenylprop-2-enyl]-oxo-phenyl-λ6-sulfane?
The IUPAC name of 2-methoxyethylimino-[(Z)-2-methyl-3-phenylprop-2-enyl]-oxo-phenyl-λ6-sulfane (CID 25038835) is 2-methoxyethylimino-[(Z)-2-methyl-3-phenylprop-2-enyl]-oxo-phenyl-λ6-sulfane.
What is the SMILES notation for 2-methoxyethylimino-[(Z)-2-methyl-3-phenylprop-2-enyl]-oxo-phenyl-λ6-sulfane?
The canonical SMILES for 2-methoxyethylimino-[(Z)-2-methyl-3-phenylprop-2-enyl]-oxo-phenyl-λ6-sulfane is COCCN=[S@](=O)(C/C(C)=C\c1ccccc1)c1ccccc1.
What is the InChIKey of 2-methoxyethylimino-[(Z)-2-methyl-3-phenylprop-2-enyl]-oxo-phenyl-λ6-sulfane?
The InChIKey is QGUPJPRDARULNS-ZBORUMQWSA-N. The full InChI is InChI=1S/C19H23NO2S/c1-17(15-18-9-5-3-6-10-18)16-23(21,20-13-14-22-2)19-11-7-4-8-12-19/h3-12,15H,13-14,16H2,1-2H3/b17-15-/t23-/m0/s1.
What are the key properties of 2-methoxyethylimino-[(Z)-2-methyl-3-phenylprop-2-enyl]-oxo-phenyl-λ6-sulfane?
2-methoxyethylimino-[(Z)-2-methyl-3-phenylprop-2-enyl]-oxo-phenyl-λ6-sulfane has a molecular weight of 329.47 g/mol, XLogP of 4.26, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxyethylimino-[(Z)-2-methyl-3-phenylprop-2-enyl]-oxo-phenyl-λ6-sulfane is sourced from PubChem (CID 25038835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).