C11H14O4S — CID 90282148
(E)-3-(4-methoxyphenyl)-2-methylprop-2-ene-1-sulfonic acid (PubChem CID 90282148) has the molecular formula C11H14O4S and a molecular weight of 242.30 g/mol. Its IUPAC name is (E)-3-(4-methoxyphenyl)-2-methylprop-2-ene-1-sulfonic acid.
| Compound Name | (E)-3-(4-methoxyphenyl)-2-methylprop-2-ene-1-sulfonic acid |
|---|---|
| PubChem CID | 90282148 |
| Molecular Formula | C11H14O4S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | (E)-3-(4-methoxyphenyl)-2-methylprop-2-ene-1-sulfonic acid |
| SMILES | COc1ccc(/C=C(\C)CS(=O)(=O)O)cc1 |
| InChI | InChI=1S/C11H14O4S/c1-9(8-16(12,13)14)7-10-3-5-11(15-2)6-4-10/h3-7H,8H2,1-2H3,(H,12,13,14)/b9-7+ |
| InChIKey | NCQABNVFOZQXLG-VQHVLOKHSA-N |
| XLogP | 1.99 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|