C25H22N6O3S — CID 25038979
4-amino-N-(2-phenylethyl)-9-(4-sulfamoylphenyl)pyrimido[4,5-b]indole-2-carboxamide (PubChem CID 25038979) has the molecular formula C25H22N6O3S and a molecular weight of 486.56 g/mol. Its IUPAC name is 4-amino-N-(2-phenylethyl)-9-(4-sulfamoylphenyl)pyrimido[4,5-b]indole-2-carboxamide.
| Compound Name | 4-amino-N-(2-phenylethyl)-9-(4-sulfamoylphenyl)pyrimido[4,5-b]indole-2-carboxamide |
|---|---|
| PubChem CID | 25038979 |
| Molecular Formula | C25H22N6O3S |
| Molecular Weight | 486.56 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | 4-amino-N-(2-phenylethyl)-9-(4-sulfamoylphenyl)pyrimido[4,5-b]indole-2-carboxamide |
| SMILES | Nc1nc(C(=O)NCCc2ccccc2)nc2c1c1ccccc1n2-c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C25H22N6O3S/c26-22-21-19-8-4-5-9-20(19)31(17-10-12-18(13-11-17)35(27,33)34)24(21)30-23(29-22)25(32)28-15-14-16-6-2-1-3-7-16/h1-13H,14-15H2,(H,28,32)(H2,26,29,30)(H2,27,33,34) |
| InChIKey | JIGCCFUYWSYGKP-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 145.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.56 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |