C22H18N6O5S — CID 25039785
[2-oxo-2-[4-(pyrimidin-2-ylsulfamoyl)anilino]ethyl] 4-(1H-imidazol-2-yl)benzoate (PubChem CID 25039785) has the molecular formula C22H18N6O5S and a molecular weight of 478.49 g/mol. Its IUPAC name is [2-oxo-2-[4-(pyrimidin-2-ylsulfamoyl)anilino]ethyl] 4-(1H-imidazol-2-yl)benzoate.
| Compound Name | [2-oxo-2-[4-(pyrimidin-2-ylsulfamoyl)anilino]ethyl] 4-(1H-imidazol-2-yl)benzoate |
|---|---|
| PubChem CID | 25039785 |
| Molecular Formula | C22H18N6O5S |
| Molecular Weight | 478.49 g/mol |
| Exact Mass | 478.11 |
| IUPAC Name | [2-oxo-2-[4-(pyrimidin-2-ylsulfamoyl)anilino]ethyl] 4-(1H-imidazol-2-yl)benzoate |
| SMILES | O=C(COC(=O)c1ccc(-c2ncc[nH]2)cc1)Nc1ccc(S(=O)(=O)Nc2ncccn2)cc1 |
| InChI | InChI=1S/C22H18N6O5S/c29-19(14-33-21(30)16-4-2-15(3-5-16)20-23-12-13-24-20)27-17-6-8-18(9-7-17)34(31,32)28-22-25-10-1-11-26-22/h1-13H,14H2,(H,23,24)(H,27,29)(H,25,26,28) |
| InChIKey | GHDSBVNOBBKDFA-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 156.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.49 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |