C27H21N5O5S — CID 25043323
[2-oxo-2-[4-(pyridin-2-ylsulfamoyl)anilino]ethyl] 2-phenyl-3H-benzimidazole-5-carboxylate (PubChem CID 25043323) has the molecular formula C27H21N5O5S and a molecular weight of 527.56 g/mol. Its IUPAC name is [2-oxo-2-[4-(pyridin-2-ylsulfamoyl)anilino]ethyl] 2-phenyl-3H-benzimidazole-5-carboxylate.
| Compound Name | [2-oxo-2-[4-(pyridin-2-ylsulfamoyl)anilino]ethyl] 2-phenyl-3H-benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 25043323 |
| Molecular Formula | C27H21N5O5S |
| Molecular Weight | 527.56 g/mol |
| Exact Mass | 527.13 |
| IUPAC Name | [2-oxo-2-[4-(pyridin-2-ylsulfamoyl)anilino]ethyl] 2-phenyl-3H-benzimidazole-5-carboxylate |
| SMILES | O=C(COC(=O)c1ccc2nc(-c3ccccc3)[nH]c2c1)Nc1ccc(S(=O)(=O)Nc2ccccn2)cc1 |
| InChI | InChI=1S/C27H21N5O5S/c33-25(29-20-10-12-21(13-11-20)38(35,36)32-24-8-4-5-15-28-24)17-37-27(34)19-9-14-22-23(16-19)31-26(30-22)18-6-2-1-3-7-18/h1-16H,17H2,(H,28,32)(H,29,33)(H,30,31) |
| InChIKey | WEVCXEXKYOZEJF-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 143.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.56 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |