C11H12BrNO4S2 — CID 25040467
5-bromo-2-methoxy-N-(2-oxothiolan-3-yl)benzenesulfonamide (PubChem CID 25040467) has the molecular formula C11H12BrNO4S2 and a molecular weight of 366.26 g/mol. Its IUPAC name is 5-bromo-2-methoxy-N-(2-oxothiolan-3-yl)benzenesulfonamide.
| Compound Name | 5-bromo-2-methoxy-N-(2-oxothiolan-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 25040467 |
| Molecular Formula | C11H12BrNO4S2 |
| Molecular Weight | 366.26 g/mol |
| Exact Mass | 364.94 |
| IUPAC Name | 5-bromo-2-methoxy-N-(2-oxothiolan-3-yl)benzenesulfonamide |
| SMILES | COc1ccc(Br)cc1S(=O)(=O)NC1CCSC1=O |
| InChI | InChI=1S/C11H12BrNO4S2/c1-17-9-3-2-7(12)6-10(9)19(15,16)13-8-4-5-18-11(8)14/h2-3,6,8,13H,4-5H2,1H3 |
| InChIKey | PMERBAFQDMJJJU-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.26 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|