C12H13BrO3S — CID 165437914
1-(5-bromo-2-methoxyphenyl)sulfonylbicyclo[1.1.1]pentane (PubChem CID 165437914) has the molecular formula C12H13BrO3S and a molecular weight of 317.20 g/mol. Its IUPAC name is 1-(5-bromo-2-methoxyphenyl)sulfonylbicyclo[1.1.1]pentane.
| Compound Name | 1-(5-bromo-2-methoxyphenyl)sulfonylbicyclo[1.1.1]pentane |
|---|---|
| PubChem CID | 165437914 |
| Molecular Formula | C12H13BrO3S |
| Molecular Weight | 317.20 g/mol |
| Exact Mass | 315.98 |
| IUPAC Name | 1-(5-bromo-2-methoxyphenyl)sulfonylbicyclo[1.1.1]pentane |
| SMILES | COc1ccc(Br)cc1S(=O)(=O)C12CC(C1)C2 |
| InChI | InChI=1S/C12H13BrO3S/c1-16-10-3-2-9(13)4-11(10)17(14,15)12-5-8(6-12)7-12/h2-4,8H,5-7H2,1H3 |
| InChIKey | LWWYMZALOVJOTO-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.20 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |