C14H14ClN3O5S — CID 25046045
4-chloro-N-(2,6-dimethoxy-3-pyridinyl)-3-sulfamoylbenzamide (PubChem CID 25046045) has the molecular formula C14H14ClN3O5S and a molecular weight of 371.80 g/mol. Its IUPAC name is 4-chloro-N-(2,6-dimethoxy-3-pyridinyl)-3-sulfamoylbenzamide.
| Compound Name | 4-chloro-N-(2,6-dimethoxy-3-pyridinyl)-3-sulfamoylbenzamide |
|---|---|
| PubChem CID | 25046045 |
| Molecular Formula | C14H14ClN3O5S |
| Molecular Weight | 371.80 g/mol |
| Exact Mass | 371.03 |
| IUPAC Name | 4-chloro-N-(2,6-dimethoxy-3-pyridinyl)-3-sulfamoylbenzamide |
| SMILES | COc1ccc(NC(=O)c2ccc(Cl)c(S(N)(=O)=O)c2)c(OC)n1 |
| InChI | InChI=1S/C14H14ClN3O5S/c1-22-12-6-5-10(14(18-12)23-2)17-13(19)8-3-4-9(15)11(7-8)24(16,20)21/h3-7H,1-2H3,(H,17,19)(H2,16,20,21) |
| InChIKey | DBCZISVYKRRQHK-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 120.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.80 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |