C11H13N5O2S3 — CID 25048375
1-methyl-3-[4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfamoyl]phenyl]thiourea (PubChem CID 25048375) has the molecular formula C11H13N5O2S3 and a molecular weight of 343.46 g/mol. Its IUPAC name is 1-methyl-3-[4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfamoyl]phenyl]thiourea.
| Compound Name | 1-methyl-3-[4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfamoyl]phenyl]thiourea |
|---|---|
| PubChem CID | 25048375 |
| Molecular Formula | C11H13N5O2S3 |
| Molecular Weight | 343.46 g/mol |
| Exact Mass | 343.02 |
| IUPAC Name | 1-methyl-3-[4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfamoyl]phenyl]thiourea |
| SMILES | CNC(=S)Nc1ccc(S(=O)(=O)Nc2nnc(C)s2)cc1 |
| InChI | InChI=1S/C11H13N5O2S3/c1-7-14-15-11(20-7)16-21(17,18)9-5-3-8(4-6-9)13-10(19)12-2/h3-6H,1-2H3,(H,15,16)(H2,12,13,19) |
| InChIKey | BNCDWZLVZPTHHG-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.46 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|