C11H12N4O6S2 — CID 139147987
2-hydroxy-2-oxoacetate;[4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfamoyl]phenyl]azanium (PubChem CID 139147987) has the molecular formula C11H12N4O6S2 and a molecular weight of 360.37 g/mol. Its IUPAC name is 2-hydroxy-2-oxoacetate;[4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfamoyl]phenyl]azanium.
| Compound Name | 2-hydroxy-2-oxoacetate;[4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfamoyl]phenyl]azanium |
|---|---|
| PubChem CID | 139147987 |
| Molecular Formula | C11H12N4O6S2 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.02 |
| IUPAC Name | 2-hydroxy-2-oxoacetate;[4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfamoyl]phenyl]azanium |
| SMILES | Cc1nnc(NS(=O)(=O)c2ccc([NH3+])cc2)s1.O=C([O-])C(=O)O |
| InChI | InChI=1S/C9H10N4O2S2.C2H2O4/c1-6-11-12-9(16-6)13-17(14,15)8-4-2-7(10)3-5-8;3-1(4)2(5)6/h2-5H,10H2,1H3,(H,12,13);(H,3,4)(H,5,6) |
| InChIKey | PQCNHTKSHRIYDH-UHFFFAOYSA-N |
| XLogP | -1.66 |
| TPSA | 177.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|