C21H22N6O5S2 — CID 171151925
N-(4-ethoxyphenyl)-3-hydroxy-2-[[4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfamoyl]phenyl]diazenyl]but-2-enamide (PubChem CID 171151925) has the molecular formula C21H22N6O5S2 and a molecular weight of 502.58 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-3-hydroxy-2-[[4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfamoyl]phenyl]diazenyl]but-2-enamide.
| Compound Name | N-(4-ethoxyphenyl)-3-hydroxy-2-[[4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfamoyl]phenyl]diazenyl]but-2-enamide |
|---|---|
| PubChem CID | 171151925 |
| Molecular Formula | C21H22N6O5S2 |
| Molecular Weight | 502.58 g/mol |
| Exact Mass | 502.11 |
| IUPAC Name | N-(4-ethoxyphenyl)-3-hydroxy-2-[[4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfamoyl]phenyl]diazenyl]but-2-enamide |
| SMILES | CCOc1ccc(NC(=O)C(/N=N/c2ccc(S(=O)(=O)Nc3nnc(C)s3)cc2)=C(C)O)cc1 |
| InChI | InChI=1S/C21H22N6O5S2/c1-4-32-17-9-5-15(6-10-17)22-20(29)19(13(2)28)25-24-16-7-11-18(12-8-16)34(30,31)27-21-26-23-14(3)33-21/h5-12,28H,4H2,1-3H3,(H,22,29)(H,26,27)/b19-13?,25-24+ |
| InChIKey | UPHKIPDKWQZPCD-ACLDLCKGSA-N |
| XLogP | 4.56 |
| TPSA | 155.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.58 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|