C15H9F3N2O2S — CID 25049723
N-(3,4,5-trifluorophenyl)isoquinoline-5-sulfonamide (PubChem CID 25049723) has the molecular formula C15H9F3N2O2S and a molecular weight of 338.31 g/mol. Its IUPAC name is N-(3,4,5-trifluorophenyl)isoquinoline-5-sulfonamide.
| Compound Name | N-(3,4,5-trifluorophenyl)isoquinoline-5-sulfonamide |
|---|---|
| PubChem CID | 25049723 |
| Molecular Formula | C15H9F3N2O2S |
| Molecular Weight | 338.31 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | N-(3,4,5-trifluorophenyl)isoquinoline-5-sulfonamide |
| SMILES | O=S(=O)(Nc1cc(F)c(F)c(F)c1)c1cccc2cnccc12 |
| InChI | InChI=1S/C15H9F3N2O2S/c16-12-6-10(7-13(17)15(12)18)20-23(21,22)14-3-1-2-9-8-19-5-4-11(9)14/h1-8,20H |
| InChIKey | HHYDSBOTKKQIBE-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.31 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|