C20H21ClN4O2S2 — CID 25050431
2-[3-[[(5-chlorothiophene-2-carbonyl)amino]methyl]phenyl]-5-methyl-1,4,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide (PubChem CID 25050431) has the molecular formula C20H21ClN4O2S2 and a molecular weight of 449.00 g/mol. Its IUPAC name is 2-[3-[[(5-chlorothiophene-2-carbonyl)amino]methyl]phenyl]-5-methyl-1,4,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide.
| Compound Name | 2-[3-[[(5-chlorothiophene-2-carbonyl)amino]methyl]phenyl]-5-methyl-1,4,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 25050431 |
| Molecular Formula | C20H21ClN4O2S2 |
| Molecular Weight | 449.00 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | 2-[3-[[(5-chlorothiophene-2-carbonyl)amino]methyl]phenyl]-5-methyl-1,4,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide |
| SMILES | CN1CCC2=C(C1)SC(C(N)=O)(c1cccc(CNC(=O)c3ccc(Cl)s3)c1)N2 |
| InChI | InChI=1S/C20H21ClN4O2S2/c1-25-8-7-14-16(11-25)29-20(24-14,19(22)27)13-4-2-3-12(9-13)10-23-18(26)15-5-6-17(21)28-15/h2-6,9,24H,7-8,10-11H2,1H3,(H2,22,27)(H,23,26) |
| InChIKey | SHIWNVUPOUCXHQ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.00 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |