C21H25N7O2 — CID 25051258
[4-(4-methoxyphenyl)piperazin-1-yl]-(5-pyrrolidin-1-yltriazolo[4,5-b]pyridin-3-yl)methanone (PubChem CID 25051258) has the molecular formula C21H25N7O2 and a molecular weight of 407.48 g/mol. Its IUPAC name is [4-(4-methoxyphenyl)piperazin-1-yl]-(5-pyrrolidin-1-yltriazolo[4,5-b]pyridin-3-yl)methanone.
| Compound Name | [4-(4-methoxyphenyl)piperazin-1-yl]-(5-pyrrolidin-1-yltriazolo[4,5-b]pyridin-3-yl)methanone |
|---|---|
| PubChem CID | 25051258 |
| Molecular Formula | C21H25N7O2 |
| Molecular Weight | 407.48 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | [4-(4-methoxyphenyl)piperazin-1-yl]-(5-pyrrolidin-1-yltriazolo[4,5-b]pyridin-3-yl)methanone |
| SMILES | COc1ccc(N2CCN(C(=O)n3nnc4ccc(N5CCCC5)nc43)CC2)cc1 |
| InChI | InChI=1S/C21H25N7O2/c1-30-17-6-4-16(5-7-17)25-12-14-27(15-13-25)21(29)28-20-18(23-24-28)8-9-19(22-20)26-10-2-3-11-26/h4-9H,2-3,10-15H2,1H3 |
| InChIKey | MGKOJBWLIJFIBJ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 79.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.48 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|