C25H16Cl2FIN2O3S — CID 25051588
(2R,3S)-2,3-bis(4-chlorophenyl)-1-(2-fluorophenyl)sulfonyl-6-iodo-2,3-dihydroimidazo[1,2-a]pyridin-5-one (PubChem CID 25051588) has the molecular formula C25H16Cl2FIN2O3S and a molecular weight of 641.29 g/mol. Its IUPAC name is (2R,3S)-2,3-bis(4-chlorophenyl)-1-(2-fluorophenyl)sulfonyl-6-iodo-2,3-dihydroimidazo[1,2-a]pyridin-5-one.
| Compound Name | (2R,3S)-2,3-bis(4-chlorophenyl)-1-(2-fluorophenyl)sulfonyl-6-iodo-2,3-dihydroimidazo[1,2-a]pyridin-5-one |
|---|---|
| PubChem CID | 25051588 |
| Molecular Formula | C25H16Cl2FIN2O3S |
| Molecular Weight | 641.29 g/mol |
| Exact Mass | 639.93 |
| IUPAC Name | (2R,3S)-2,3-bis(4-chlorophenyl)-1-(2-fluorophenyl)sulfonyl-6-iodo-2,3-dihydroimidazo[1,2-a]pyridin-5-one |
| SMILES | O=c1c(I)ccc2n1[C@@H](c1ccc(Cl)cc1)[C@@H](c1ccc(Cl)cc1)N2S(=O)(=O)c1ccccc1F |
| InChI | InChI=1S/C25H16Cl2FIN2O3S/c26-17-9-5-15(6-10-17)23-24(16-7-11-18(27)12-8-16)31(22-14-13-20(29)25(32)30(22)23)35(33,34)21-4-2-1-3-19(21)28/h1-14,23-24H/t23-,24+/m0/s1 |
| InChIKey | HSFRSIWETYSKHO-BJKOFHAPSA-N |
| XLogP | 6.44 |
| TPSA | 59.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.29 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|