C18H20F3N3O4S — CID 25052479
N-[4-(2-hydroxyethyl)-1,3-thiazol-2-yl]-4-(3,4,5-trifluoro-2-methoxyphenoxy)piperidine-1-carboxamide (PubChem CID 25052479) has the molecular formula C18H20F3N3O4S and a molecular weight of 431.44 g/mol. Its IUPAC name is N-[4-(2-hydroxyethyl)-1,3-thiazol-2-yl]-4-(3,4,5-trifluoro-2-methoxyphenoxy)piperidine-1-carboxamide.
| Compound Name | N-[4-(2-hydroxyethyl)-1,3-thiazol-2-yl]-4-(3,4,5-trifluoro-2-methoxyphenoxy)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 25052479 |
| Molecular Formula | C18H20F3N3O4S |
| Molecular Weight | 431.44 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | N-[4-(2-hydroxyethyl)-1,3-thiazol-2-yl]-4-(3,4,5-trifluoro-2-methoxyphenoxy)piperidine-1-carboxamide |
| SMILES | COc1c(OC2CCN(C(=O)Nc3nc(CCO)cs3)CC2)cc(F)c(F)c1F |
| InChI | InChI=1S/C18H20F3N3O4S/c1-27-16-13(8-12(19)14(20)15(16)21)28-11-2-5-24(6-3-11)18(26)23-17-22-10(4-7-25)9-29-17/h8-9,11,25H,2-7H2,1H3,(H,22,23,26) |
| InChIKey | RFKUQYBPPOBNIJ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 83.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.44 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|