C18H33NO7 — CID 25053377
tert-butyl (3aR,4R,6R,6aS)-6-(hydroxymethyl)-4-(2-methoxypropan-2-yloxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate (PubChem CID 25053377) has the molecular formula C18H33NO7 and a molecular weight of 375.46 g/mol. Its IUPAC name is tert-butyl (3aR,4R,6R,6aS)-6-(hydroxymethyl)-4-(2-methoxypropan-2-yloxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate.
| Compound Name | tert-butyl (3aR,4R,6R,6aS)-6-(hydroxymethyl)-4-(2-methoxypropan-2-yloxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 25053377 |
| Molecular Formula | C18H33NO7 |
| Molecular Weight | 375.46 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | tert-butyl (3aR,4R,6R,6aS)-6-(hydroxymethyl)-4-(2-methoxypropan-2-yloxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
| SMILES | COC(C)(C)OC[C@@H]1[C@H]2OC(C)(C)O[C@H]2[C@@H](CO)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H33NO7/c1-16(2,3)26-15(21)19-11(9-20)13-14(25-18(6,7)24-13)12(19)10-23-17(4,5)22-8/h11-14,20H,9-10H2,1-8H3/t11-,12-,13+,14-/m1/s1 |
| InChIKey | XEZVCFUODRYFAC-YIYPIFLZSA-N |
| XLogP | 1.89 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.46 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|