C10H8ClF3OS — CID 25053613
S-(2,2,2-trifluoroethyl) 2-(4-chlorophenyl)ethanethioate (PubChem CID 25053613) has the molecular formula C10H8ClF3OS and a molecular weight of 268.69 g/mol. Its IUPAC name is S-(2,2,2-trifluoroethyl) 2-(4-chlorophenyl)ethanethioate.
| Compound Name | S-(2,2,2-trifluoroethyl) 2-(4-chlorophenyl)ethanethioate |
|---|---|
| PubChem CID | 25053613 |
| Molecular Formula | C10H8ClF3OS |
| Molecular Weight | 268.69 g/mol |
| Exact Mass | 267.99 |
| IUPAC Name | S-(2,2,2-trifluoroethyl) 2-(4-chlorophenyl)ethanethioate |
| SMILES | O=C(Cc1ccc(Cl)cc1)SCC(F)(F)F |
| InChI | InChI=1S/C10H8ClF3OS/c11-8-3-1-7(2-4-8)5-9(15)16-6-10(12,13)14/h1-4H,5-6H2 |
| InChIKey | CEEYMYNCHZURHN-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.69 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|