C25H24N2O5 — CID 25053657
[(4E)-2-(hydroxymethyl)-5-oxo-4-(quinolin-3-ylmethylidene)oxolan-2-yl]methyl 4-(dimethylamino)benzoate (PubChem CID 25053657) has the molecular formula C25H24N2O5 and a molecular weight of 432.48 g/mol. Its IUPAC name is [(4E)-2-(hydroxymethyl)-5-oxo-4-(quinolin-3-ylmethylidene)oxolan-2-yl]methyl 4-(dimethylamino)benzoate.
| Compound Name | [(4E)-2-(hydroxymethyl)-5-oxo-4-(quinolin-3-ylmethylidene)oxolan-2-yl]methyl 4-(dimethylamino)benzoate |
|---|---|
| PubChem CID | 25053657 |
| Molecular Formula | C25H24N2O5 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | [(4E)-2-(hydroxymethyl)-5-oxo-4-(quinolin-3-ylmethylidene)oxolan-2-yl]methyl 4-(dimethylamino)benzoate |
| SMILES | CN(C)c1ccc(C(=O)OCC2(CO)C/C(=C\c3cnc4ccccc4c3)C(=O)O2)cc1 |
| InChI | InChI=1S/C25H24N2O5/c1-27(2)21-9-7-18(8-10-21)23(29)31-16-25(15-28)13-20(24(30)32-25)12-17-11-19-5-3-4-6-22(19)26-14-17/h3-12,14,28H,13,15-16H2,1-2H3/b20-12+ |
| InChIKey | DEQHLCSNLCBPHA-UDWIEESQSA-N |
| XLogP | 3.22 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|