C20H23NO7 — CID 25054341
[(3R)-3-phenoxycarbonyloxybutan-2-yl] (2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoate (PubChem CID 25054341) has the molecular formula C20H23NO7 and a molecular weight of 389.40 g/mol. Its IUPAC name is [(3R)-3-phenoxycarbonyloxybutan-2-yl] (2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoate.
| Compound Name | [(3R)-3-phenoxycarbonyloxybutan-2-yl] (2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 25054341 |
| Molecular Formula | C20H23NO7 |
| Molecular Weight | 389.40 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | [(3R)-3-phenoxycarbonyloxybutan-2-yl] (2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoate |
| SMILES | CC(OC(=O)[C@@H](N)Cc1ccc(O)c(O)c1)[C@@H](C)OC(=O)Oc1ccccc1 |
| InChI | InChI=1S/C20H23NO7/c1-12(13(2)27-20(25)28-15-6-4-3-5-7-15)26-19(24)16(21)10-14-8-9-17(22)18(23)11-14/h3-9,11-13,16,22-23H,10,21H2,1-2H3/t12?,13-,16+/m1/s1 |
| InChIKey | VFTVWGAEOSGUNA-QVNUIZJESA-N |
| XLogP | 2.50 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.40 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|