C19H29NO7 — CID 91272253
[(2S,3S)-3-(2-methylbutoxycarbonyloxy)butan-2-yl] (2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoate (PubChem CID 91272253) has the molecular formula C19H29NO7 and a molecular weight of 383.44 g/mol. Its IUPAC name is [(2S,3S)-3-(2-methylbutoxycarbonyloxy)butan-2-yl] (2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoate.
| Compound Name | [(2S,3S)-3-(2-methylbutoxycarbonyloxy)butan-2-yl] (2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 91272253 |
| Molecular Formula | C19H29NO7 |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | [(2S,3S)-3-(2-methylbutoxycarbonyloxy)butan-2-yl] (2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoate |
| SMILES | CCC(C)COC(=O)O[C@@H](C)[C@H](C)OC(=O)[C@@H](N)Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C19H29NO7/c1-5-11(2)10-25-19(24)27-13(4)12(3)26-18(23)15(20)8-14-6-7-16(21)17(22)9-14/h6-7,9,11-13,15,21-22H,5,8,10,20H2,1-4H3/t11?,12-,13-,15-/m0/s1 |
| InChIKey | NXEKCVMAOKSJRY-SQWANPQRSA-N |
| XLogP | 2.49 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|