C28H34N4O2 — CID 25057383
1-[1-[2-[di(propan-2-yl)amino]ethyl]indazol-5-yl]-4-(1-phenylethoxy)pyridin-2-one (PubChem CID 25057383) has the molecular formula C28H34N4O2 and a molecular weight of 458.61 g/mol. Its IUPAC name is 1-[1-[2-[di(propan-2-yl)amino]ethyl]indazol-5-yl]-4-(1-phenylethoxy)pyridin-2-one.
| Compound Name | 1-[1-[2-[di(propan-2-yl)amino]ethyl]indazol-5-yl]-4-(1-phenylethoxy)pyridin-2-one |
|---|---|
| PubChem CID | 25057383 |
| Molecular Formula | C28H34N4O2 |
| Molecular Weight | 458.61 g/mol |
| Exact Mass | 458.27 |
| IUPAC Name | 1-[1-[2-[di(propan-2-yl)amino]ethyl]indazol-5-yl]-4-(1-phenylethoxy)pyridin-2-one |
| SMILES | CC(Oc1ccn(-c2ccc3c(cnn3CCN(C(C)C)C(C)C)c2)c(=O)c1)c1ccccc1 |
| InChI | InChI=1S/C28H34N4O2/c1-20(2)30(21(3)4)15-16-32-27-12-11-25(17-24(27)19-29-32)31-14-13-26(18-28(31)33)34-22(5)23-9-7-6-8-10-23/h6-14,17-22H,15-16H2,1-5H3 |
| InChIKey | KDCAUEIPTUWLBI-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 52.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.61 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |