C27H32N4O2 — CID 71039149
1-[1-[2-[ethyl(propyl)amino]ethyl]indazol-5-yl]-4-(4-methoxy-2-methylphenyl)pyridin-2-one (PubChem CID 71039149) has the molecular formula C27H32N4O2 and a molecular weight of 444.58 g/mol. Its IUPAC name is 1-[1-[2-[ethyl(propyl)amino]ethyl]indazol-5-yl]-4-(4-methoxy-2-methylphenyl)pyridin-2-one.
| Compound Name | 1-[1-[2-[ethyl(propyl)amino]ethyl]indazol-5-yl]-4-(4-methoxy-2-methylphenyl)pyridin-2-one |
|---|---|
| PubChem CID | 71039149 |
| Molecular Formula | C27H32N4O2 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | 1-[1-[2-[ethyl(propyl)amino]ethyl]indazol-5-yl]-4-(4-methoxy-2-methylphenyl)pyridin-2-one |
| SMILES | CCCN(CC)CCn1ncc2cc(-n3ccc(-c4ccc(OC)cc4C)cc3=O)ccc21 |
| InChI | InChI=1S/C27H32N4O2/c1-5-12-29(6-2)14-15-31-26-10-7-23(17-22(26)19-28-31)30-13-11-21(18-27(30)32)25-9-8-24(33-4)16-20(25)3/h7-11,13,16-19H,5-6,12,14-15H2,1-4H3 |
| InChIKey | XLVXZZJTFVZDCN-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 52.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |