C24H21N5O — CID 25057928
7-[[4-(1-hydroxycyclopentyl)triazol-1-yl]methyl]-4-phenylquinoline-2-carbonitrile (PubChem CID 25057928) has the molecular formula C24H21N5O and a molecular weight of 395.47 g/mol. Its IUPAC name is 7-[[4-(1-hydroxycyclopentyl)triazol-1-yl]methyl]-4-phenylquinoline-2-carbonitrile.
| Compound Name | 7-[[4-(1-hydroxycyclopentyl)triazol-1-yl]methyl]-4-phenylquinoline-2-carbonitrile |
|---|---|
| PubChem CID | 25057928 |
| Molecular Formula | C24H21N5O |
| Molecular Weight | 395.47 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 7-[[4-(1-hydroxycyclopentyl)triazol-1-yl]methyl]-4-phenylquinoline-2-carbonitrile |
| SMILES | N#Cc1cc(-c2ccccc2)c2ccc(Cn3cc(C4(O)CCCC4)nn3)cc2n1 |
| InChI | InChI=1S/C24H21N5O/c25-14-19-13-21(18-6-2-1-3-7-18)20-9-8-17(12-22(20)26-19)15-29-16-23(27-28-29)24(30)10-4-5-11-24/h1-3,6-9,12-13,16,30H,4-5,10-11,15H2 |
| InChIKey | CAUCKYZPQMWIIS-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 87.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.47 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |