C27H37KO7 — CID 25057995
potassium (E)-2-[(E)-2-[(1R,5R,6R,8aR)-6-acetyloxy-5,8a-dimethyl-2-methylidene-5-(prop-1-en-2-yloxymethyl)-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethenyl]-4-acetyloxybut-2-enoate (PubChem CID 25057995) has the molecular formula C27H37KO7 and a molecular weight of 512.68 g/mol. Its IUPAC name is potassium (E)-2-[(E)-2-[(1R,5R,6R,8aR)-6-acetyloxy-5,8a-dimethyl-2-methylidene-5-(prop-1-en-2-yloxymethyl)-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethenyl]-4-acetyloxybut-2-enoate.
| Compound Name | potassium (E)-2-[(E)-2-[(1R,5R,6R,8aR)-6-acetyloxy-5,8a-dimethyl-2-methylidene-5-(prop-1-en-2-yloxymethyl)-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethenyl]-4-acetyloxybut-2-enoate |
|---|---|
| PubChem CID | 25057995 |
| Molecular Formula | C27H37KO7 |
| Molecular Weight | 512.68 g/mol |
| Exact Mass | 512.22 |
| IUPAC Name | potassium (E)-2-[(E)-2-[(1R,5R,6R,8aR)-6-acetyloxy-5,8a-dimethyl-2-methylidene-5-(prop-1-en-2-yloxymethyl)-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethenyl]-4-acetyloxybut-2-enoate |
| SMILES | C=C(C)OC[C@@]1(C)C2CCC(=C)[C@@H](/C=C/C(=C\COC(C)=O)C(=O)[O-])[C@]2(C)CC[C@H]1OC(C)=O.[K+] |
| InChI | InChI=1S/C27H38O7.K/c1-17(2)33-16-27(7)23-11-8-18(3)22(26(23,6)14-12-24(27)34-20(5)29)10-9-21(25(30)31)13-15-32-19(4)28;/h9-10,13,22-24H,1,3,8,11-12,14-16H2,2,4-7H3,(H,30,31);/q;+1/p-1/b10-9+,21-13+;/t22-,23?,24-,26+,27+;/m1./s1 |
| InChIKey | OCNMNDADJFWNFD-YWLJWRNNSA-M |
| XLogP | 0.66 |
| TPSA | 101.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.68 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|