C28H40O8 — CID 25054090
(E)-2-[(E)-2-[(1R,5R,6R,8aR)-5,8a-dimethyl-2-methylidene-6-propanoyloxy-5-(propanoyloxymethyl)-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethenyl]-4-acetyloxybut-2-enoic acid (PubChem CID 25054090) has the molecular formula C28H40O8 and a molecular weight of 504.62 g/mol. Its IUPAC name is (E)-2-[(E)-2-[(1R,5R,6R,8aR)-5,8a-dimethyl-2-methylidene-6-propanoyloxy-5-(propanoyloxymethyl)-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethenyl]-4-acetyloxybut-2-enoic acid.
| Compound Name | (E)-2-[(E)-2-[(1R,5R,6R,8aR)-5,8a-dimethyl-2-methylidene-6-propanoyloxy-5-(propanoyloxymethyl)-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethenyl]-4-acetyloxybut-2-enoic acid |
|---|---|
| PubChem CID | 25054090 |
| Molecular Formula | C28H40O8 |
| Molecular Weight | 504.62 g/mol |
| Exact Mass | 504.27 |
| IUPAC Name | (E)-2-[(E)-2-[(1R,5R,6R,8aR)-5,8a-dimethyl-2-methylidene-6-propanoyloxy-5-(propanoyloxymethyl)-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethenyl]-4-acetyloxybut-2-enoic acid |
| SMILES | C=C1CCC2[C@](C)(COC(=O)CC)[C@H](OC(=O)CC)CC[C@@]2(C)[C@@H]1/C=C/C(=C\COC(C)=O)C(=O)O |
| InChI | InChI=1S/C28H40O8/c1-7-24(30)35-17-28(6)22-12-9-18(3)21(11-10-20(26(32)33)14-16-34-19(4)29)27(22,5)15-13-23(28)36-25(31)8-2/h10-11,14,21-23H,3,7-9,12-13,15-17H2,1-2,4-6H3,(H,32,33)/b11-10+,20-14+/t21-,22?,23-,27+,28+/m1/s1 |
| InChIKey | PBZAJHYQRRUHHI-DNXQGJEGSA-N |
| XLogP | 4.78 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.62 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|