C29H38O9 — CID 44601145
6-[(1S,2R,4aR,5R)-2-(3-carboxypropanoyloxy)-1,4a-dimethyl-6-methylidene-5-[(E)-2-(5-oxo-2H-furan-4-yl)ethenyl]-3,4,5,7,8,8a-hexahydro-2H-naphthalen-1-yl]-4-oxohexanoic acid (PubChem CID 44601145) has the molecular formula C29H38O9 and a molecular weight of 530.61 g/mol. Its IUPAC name is 6-[(1S,2R,4aR,5R)-2-(3-carboxypropanoyloxy)-1,4a-dimethyl-6-methylidene-5-[(E)-2-(5-oxo-2H-furan-4-yl)ethenyl]-3,4,5,7,8,8a-hexahydro-2H-naphthalen-1-yl]-4-oxohexanoic acid.
| Compound Name | 6-[(1S,2R,4aR,5R)-2-(3-carboxypropanoyloxy)-1,4a-dimethyl-6-methylidene-5-[(E)-2-(5-oxo-2H-furan-4-yl)ethenyl]-3,4,5,7,8,8a-hexahydro-2H-naphthalen-1-yl]-4-oxohexanoic acid |
|---|---|
| PubChem CID | 44601145 |
| Molecular Formula | C29H38O9 |
| Molecular Weight | 530.61 g/mol |
| Exact Mass | 530.25 |
| IUPAC Name | 6-[(1S,2R,4aR,5R)-2-(3-carboxypropanoyloxy)-1,4a-dimethyl-6-methylidene-5-[(E)-2-(5-oxo-2H-furan-4-yl)ethenyl]-3,4,5,7,8,8a-hexahydro-2H-naphthalen-1-yl]-4-oxohexanoic acid |
| SMILES | C=C1CCC2[C@](C)(CCC(=O)CCC(=O)O)[C@H](OC(=O)CCC(=O)O)CC[C@@]2(C)[C@@H]1/C=C/C1=CCOC1=O |
| InChI | InChI=1S/C29H38O9/c1-18-4-8-22-28(2,21(18)7-5-19-14-17-37-27(19)36)16-13-23(38-26(35)11-10-25(33)34)29(22,3)15-12-20(30)6-9-24(31)32/h5,7,14,21-23H,1,4,6,8-13,15-17H2,2-3H3,(H,31,32)(H,33,34)/b7-5+/t21-,22?,23-,28+,29+/m1/s1 |
| InChIKey | GQESWOIJUYWIKS-ZWGXUIMFSA-N |
| XLogP | 4.41 |
| TPSA | 144.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.61 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|