C20H27O6P — CID 112758139
4-[(E)-2-(3-hydroxy-6a,10b-dimethyl-8-methylidene-3-oxo-1,4a,5,6,7,9,10,10a-octahydronaphtho[2,1-d][1,3,2]dioxaphosphinin-7-yl)ethenyl]-2H-furan-5-one (PubChem CID 112758139) has the molecular formula C20H27O6P and a molecular weight of 394.40 g/mol. Its IUPAC name is 4-[(E)-2-(3-hydroxy-6a,10b-dimethyl-8-methylidene-3-oxo-1,4a,5,6,7,9,10,10a-octahydronaphtho[2,1-d][1,3,2]dioxaphosphinin-7-yl)ethenyl]-2H-furan-5-one.
| Compound Name | 4-[(E)-2-(3-hydroxy-6a,10b-dimethyl-8-methylidene-3-oxo-1,4a,5,6,7,9,10,10a-octahydronaphtho[2,1-d][1,3,2]dioxaphosphinin-7-yl)ethenyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 112758139 |
| Molecular Formula | C20H27O6P |
| Molecular Weight | 394.40 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | 4-[(E)-2-(3-hydroxy-6a,10b-dimethyl-8-methylidene-3-oxo-1,4a,5,6,7,9,10,10a-octahydronaphtho[2,1-d][1,3,2]dioxaphosphinin-7-yl)ethenyl]-2H-furan-5-one |
| SMILES | C=C1CCC2C3(C)COP(=O)(O)OC3CCC2(C)C1/C=C/C1=CCOC1=O |
| InChI | InChI=1S/C20H27O6P/c1-13-4-7-16-19(2,15(13)6-5-14-9-11-24-18(14)21)10-8-17-20(16,3)12-25-27(22,23)26-17/h5-6,9,15-17H,1,4,7-8,10-12H2,2-3H3,(H,22,23)/b6-5+ |
| InChIKey | AYPLIDKPCSUKFQ-AATRIKPKSA-N |
| XLogP | 3.93 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.40 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|