C26H38NO6P — CID 57329233
methyl 2-[[(4aR,6aS,10bR)-6a,10b-dimethyl-8-methylidene-7-[(E)-2-(5-oxo-2H-furan-4-yl)ethenyl]-1,4a,5,6,7,9,10,10a-octahydronaphtho[2,1-d][1,3,2]dioxaphosphinin-3-yl]amino]-3-methylbutanoate (PubChem CID 57329233) has the molecular formula C26H38NO6P and a molecular weight of 491.57 g/mol. Its IUPAC name is methyl 2-[[(4aR,6aS,10bR)-6a,10b-dimethyl-8-methylidene-7-[(E)-2-(5-oxo-2H-furan-4-yl)ethenyl]-1,4a,5,6,7,9,10,10a-octahydronaphtho[2,1-d][1,3,2]dioxaphosphinin-3-yl]amino]-3-methylbutanoate.
| Compound Name | methyl 2-[[(4aR,6aS,10bR)-6a,10b-dimethyl-8-methylidene-7-[(E)-2-(5-oxo-2H-furan-4-yl)ethenyl]-1,4a,5,6,7,9,10,10a-octahydronaphtho[2,1-d][1,3,2]dioxaphosphinin-3-yl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 57329233 |
| Molecular Formula | C26H38NO6P |
| Molecular Weight | 491.57 g/mol |
| Exact Mass | 491.24 |
| IUPAC Name | methyl 2-[[(4aR,6aS,10bR)-6a,10b-dimethyl-8-methylidene-7-[(E)-2-(5-oxo-2H-furan-4-yl)ethenyl]-1,4a,5,6,7,9,10,10a-octahydronaphtho[2,1-d][1,3,2]dioxaphosphinin-3-yl]amino]-3-methylbutanoate |
| SMILES | C=C1CCC2[C@](C)(CC[C@H]3OP(NC(C(=O)OC)C(C)C)OC[C@@]23C)C1/C=C/C1=CCOC1=O |
| InChI | InChI=1S/C26H38NO6P/c1-16(2)22(24(29)30-6)27-34-32-15-26(5)20-10-7-17(3)19(9-8-18-12-14-31-23(18)28)25(20,4)13-11-21(26)33-34/h8-9,12,16,19-22,27H,3,7,10-11,13-15H2,1-2,4-6H3/b9-8+/t19?,20?,21-,22?,25-,26+,34?/m1/s1 |
| InChIKey | ZUADVFPCDLUKFF-XPCGIWBCSA-N |
| XLogP | 4.84 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.57 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|