C26H33NO4S — CID 164616182
(1S,2R,4aR,5R,8aS)-2-hydroxy-1,4a-dimethyl-6-methylidene-5-[(E)-2-(5-oxo-2H-furan-4-yl)ethenyl]-N-(2-thiophen-2-ylethyl)-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxamide (PubChem CID 164616182) has the molecular formula C26H33NO4S and a molecular weight of 455.62 g/mol. Its IUPAC name is (1S,2R,4aR,5R,8aS)-2-hydroxy-1,4a-dimethyl-6-methylidene-5-[(E)-2-(5-oxo-2H-furan-4-yl)ethenyl]-N-(2-thiophen-2-ylethyl)-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxamide.
| Compound Name | (1S,2R,4aR,5R,8aS)-2-hydroxy-1,4a-dimethyl-6-methylidene-5-[(E)-2-(5-oxo-2H-furan-4-yl)ethenyl]-N-(2-thiophen-2-ylethyl)-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 164616182 |
| Molecular Formula | C26H33NO4S |
| Molecular Weight | 455.62 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | (1S,2R,4aR,5R,8aS)-2-hydroxy-1,4a-dimethyl-6-methylidene-5-[(E)-2-(5-oxo-2H-furan-4-yl)ethenyl]-N-(2-thiophen-2-ylethyl)-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxamide |
| SMILES | C=C1CC[C@H]2[C@@](C)(CC[C@@H](O)[C@@]2(C)C(=O)NCCc2cccs2)[C@@H]1/C=C/C1=CCOC1=O |
| InChI | InChI=1S/C26H33NO4S/c1-17-6-9-21-25(2,20(17)8-7-18-12-15-31-23(18)29)13-10-22(28)26(21,3)24(30)27-14-11-19-5-4-16-32-19/h4-5,7-8,12,16,20-22,28H,1,6,9-11,13-15H2,2-3H3,(H,27,30)/b8-7+/t20-,21+,22-,25+,26+/m1/s1 |
| InChIKey | GESYZRCGMMWYHY-AAQQYLJGSA-N |
| XLogP | 4.20 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.62 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|