C20H26O4 — CID 163095682
4-[2-[5-(hydroxymethyl)-5,8a-dimethyl-2-methylidene-6-oxo-1,3,4,4a,7,8-hexahydronaphthalen-1-yl]ethenyl]furan-3-one (PubChem CID 163095682) has the molecular formula C20H26O4 and a molecular weight of 330.42 g/mol. Its IUPAC name is 4-[2-[5-(hydroxymethyl)-5,8a-dimethyl-2-methylidene-6-oxo-1,3,4,4a,7,8-hexahydronaphthalen-1-yl]ethenyl]furan-3-one.
| Compound Name | 4-[2-[5-(hydroxymethyl)-5,8a-dimethyl-2-methylidene-6-oxo-1,3,4,4a,7,8-hexahydronaphthalen-1-yl]ethenyl]furan-3-one |
|---|---|
| PubChem CID | 163095682 |
| Molecular Formula | C20H26O4 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 4-[2-[5-(hydroxymethyl)-5,8a-dimethyl-2-methylidene-6-oxo-1,3,4,4a,7,8-hexahydronaphthalen-1-yl]ethenyl]furan-3-one |
| SMILES | C=C1CCC2C(C)(CO)C(=O)CCC2(C)C1C=CC1=COCC1=O |
| InChI | InChI=1S/C20H26O4/c1-13-4-7-17-19(2,9-8-18(23)20(17,3)12-21)15(13)6-5-14-10-24-11-16(14)22/h5-6,10,15,17,21H,1,4,7-9,11-12H2,2-3H3 |
| InChIKey | OKUOCIFDEVPNSL-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|