C27H31BrO4 — CID 53259184
(5E)-3-[(E)-2-[(1R,5R,6R,8aR)-6-hydroxy-5-(hydroxymethyl)-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethenyl]-5-[(4-bromophenyl)methylidene]furan-2-one (PubChem CID 53259184) has the molecular formula C27H31BrO4 and a molecular weight of 499.45 g/mol. Its IUPAC name is (5E)-3-[(E)-2-[(1R,5R,6R,8aR)-6-hydroxy-5-(hydroxymethyl)-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethenyl]-5-[(4-bromophenyl)methylidene]furan-2-one.
| Compound Name | (5E)-3-[(E)-2-[(1R,5R,6R,8aR)-6-hydroxy-5-(hydroxymethyl)-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethenyl]-5-[(4-bromophenyl)methylidene]furan-2-one |
|---|---|
| PubChem CID | 53259184 |
| Molecular Formula | C27H31BrO4 |
| Molecular Weight | 499.45 g/mol |
| Exact Mass | 498.14 |
| IUPAC Name | (5E)-3-[(E)-2-[(1R,5R,6R,8aR)-6-hydroxy-5-(hydroxymethyl)-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethenyl]-5-[(4-bromophenyl)methylidene]furan-2-one |
| SMILES | C=C1CCC2[C@](C)(CO)[C@H](O)CC[C@@]2(C)[C@@H]1/C=C/C1=C/C(=C\c2ccc(Br)cc2)OC1=O |
| InChI | InChI=1S/C27H31BrO4/c1-17-4-11-23-26(2,13-12-24(30)27(23,3)16-29)22(17)10-7-19-15-21(32-25(19)31)14-18-5-8-20(28)9-6-18/h5-10,14-15,22-24,29-30H,1,4,11-13,16H2,2-3H3/b10-7+,21-14+/t22-,23?,24-,26+,27+/m1/s1 |
| InChIKey | IGPAEQNHLQBKPV-XVZQVHIWSA-N |
| XLogP | 5.57 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.45 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|