C27H34BrNO3 — CID 164611508
4-[(E)-2-[(1R,4aS,5R,6R,8aR)-5-[[(4-bromophenyl)methylamino]methyl]-6-hydroxy-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethenyl]-2H-furan-5-one (PubChem CID 164611508) has the molecular formula C27H34BrNO3 and a molecular weight of 500.48 g/mol. Its IUPAC name is 4-[(E)-2-[(1R,4aS,5R,6R,8aR)-5-[[(4-bromophenyl)methylamino]methyl]-6-hydroxy-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethenyl]-2H-furan-5-one.
| Compound Name | 4-[(E)-2-[(1R,4aS,5R,6R,8aR)-5-[[(4-bromophenyl)methylamino]methyl]-6-hydroxy-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethenyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 164611508 |
| Molecular Formula | C27H34BrNO3 |
| Molecular Weight | 500.48 g/mol |
| Exact Mass | 499.17 |
| IUPAC Name | 4-[(E)-2-[(1R,4aS,5R,6R,8aR)-5-[[(4-bromophenyl)methylamino]methyl]-6-hydroxy-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethenyl]-2H-furan-5-one |
| SMILES | C=C1CC[C@@H]2[C@](C)(CNCc3ccc(Br)cc3)[C@H](O)CC[C@@]2(C)[C@@H]1/C=C/C1=CCOC1=O |
| InChI | InChI=1S/C27H34BrNO3/c1-18-4-11-23-26(2,22(18)10-7-20-13-15-32-25(20)31)14-12-24(30)27(23,3)17-29-16-19-5-8-21(28)9-6-19/h5-10,13,22-24,29-30H,1,4,11-12,14-17H2,2-3H3/b10-7+/t22-,23+,24-,26+,27+/m1/s1 |
| InChIKey | GRVKPNGKXLPFCN-PNSMVNCNSA-N |
| XLogP | 5.33 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.48 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|