C30H43NO7 — CID 71712587
2-O-[[(1R,2R,4aR,5R,8aS)-2-hydroxy-1,4a-dimethyl-6-methylidene-5-[(E)-2-(5-oxo-2H-furan-4-yl)ethenyl]-3,4,5,7,8,8a-hexahydro-2H-naphthalen-1-yl]methyl] 1-O-tert-butyl pyrrolidine-1,2-dicarboxylate (PubChem CID 71712587) has the molecular formula C30H43NO7 and a molecular weight of 529.67 g/mol. Its IUPAC name is 2-O-[[(1R,2R,4aR,5R,8aS)-2-hydroxy-1,4a-dimethyl-6-methylidene-5-[(E)-2-(5-oxo-2H-furan-4-yl)ethenyl]-3,4,5,7,8,8a-hexahydro-2H-naphthalen-1-yl]methyl] 1-O-tert-butyl pyrrolidine-1,2-dicarboxylate.
| Compound Name | 2-O-[[(1R,2R,4aR,5R,8aS)-2-hydroxy-1,4a-dimethyl-6-methylidene-5-[(E)-2-(5-oxo-2H-furan-4-yl)ethenyl]-3,4,5,7,8,8a-hexahydro-2H-naphthalen-1-yl]methyl] 1-O-tert-butyl pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 71712587 |
| Molecular Formula | C30H43NO7 |
| Molecular Weight | 529.67 g/mol |
| Exact Mass | 529.30 |
| IUPAC Name | 2-O-[[(1R,2R,4aR,5R,8aS)-2-hydroxy-1,4a-dimethyl-6-methylidene-5-[(E)-2-(5-oxo-2H-furan-4-yl)ethenyl]-3,4,5,7,8,8a-hexahydro-2H-naphthalen-1-yl]methyl] 1-O-tert-butyl pyrrolidine-1,2-dicarboxylate |
| SMILES | C=C1CC[C@@H]2[C@](C)(COC(=O)C3CCCN3C(=O)OC(C)(C)C)[C@H](O)CC[C@@]2(C)[C@@H]1/C=C/C1=CCOC1=O |
| InChI | InChI=1S/C30H43NO7/c1-19-9-12-23-29(5,21(19)11-10-20-14-17-36-25(20)33)15-13-24(32)30(23,6)18-37-26(34)22-8-7-16-31(22)27(35)38-28(2,3)4/h10-11,14,21-24,32H,1,7-9,12-13,15-18H2,2-6H3/b11-10+/t21-,22?,23+,24-,29+,30+/m1/s1 |
| InChIKey | SVEQJVXJIUOTST-FGZURYLVSA-N |
| XLogP | 4.72 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.67 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|