C19H30FNO2S — CID 25058584
(2R,4R)-4-fluoro-2-heptyl-1-(4-methylphenyl)sulfonylpiperidine (PubChem CID 25058584) has the molecular formula C19H30FNO2S and a molecular weight of 355.52 g/mol. Its IUPAC name is (2R,4R)-4-fluoro-2-heptyl-1-(4-methylphenyl)sulfonylpiperidine.
| Compound Name | (2R,4R)-4-fluoro-2-heptyl-1-(4-methylphenyl)sulfonylpiperidine |
|---|---|
| PubChem CID | 25058584 |
| Molecular Formula | C19H30FNO2S |
| Molecular Weight | 355.52 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | (2R,4R)-4-fluoro-2-heptyl-1-(4-methylphenyl)sulfonylpiperidine |
| SMILES | CCCCCCC[C@@H]1C[C@H](F)CCN1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H30FNO2S/c1-3-4-5-6-7-8-18-15-17(20)13-14-21(18)24(22,23)19-11-9-16(2)10-12-19/h9-12,17-18H,3-8,13-15H2,1-2H3/t17-,18-/m1/s1 |
| InChIKey | MVTQDNXOXNDQQB-QZTJIDSGSA-N |
| XLogP | 4.85 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.52 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|