C26H41NO4S — CID 25061641
[(2R,4S,6R,7R)-4-ethenyl-3-hydroxy-2,4,7-trimethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-piperidin-3-ylsulfanylacetate (PubChem CID 25061641) has the molecular formula C26H41NO4S and a molecular weight of 463.68 g/mol. Its IUPAC name is [(2R,4S,6R,7R)-4-ethenyl-3-hydroxy-2,4,7-trimethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-piperidin-3-ylsulfanylacetate.
| Compound Name | [(2R,4S,6R,7R)-4-ethenyl-3-hydroxy-2,4,7-trimethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-piperidin-3-ylsulfanylacetate |
|---|---|
| PubChem CID | 25061641 |
| Molecular Formula | C26H41NO4S |
| Molecular Weight | 463.68 g/mol |
| Exact Mass | 463.28 |
| IUPAC Name | [(2R,4S,6R,7R)-4-ethenyl-3-hydroxy-2,4,7-trimethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-piperidin-3-ylsulfanylacetate |
| SMILES | C=C[C@]1(C)C[C@@H](OC(=O)CSC2CCCNC2)[C@]2(C)CCCC3(CCC(=O)C32)[C@@H](C)C1O |
| InChI | InChI=1S/C26H41NO4S/c1-5-24(3)14-20(31-21(29)16-32-18-8-6-13-27-15-18)25(4)10-7-11-26(17(2)23(24)30)12-9-19(28)22(25)26/h5,17-18,20,22-23,27,30H,1,6-16H2,2-4H3/t17-,18?,20+,22?,23?,24+,25-,26?/m0/s1 |
| InChIKey | PUXMLCUNTONQTA-MIOPYIAWSA-N |
| XLogP | 4.13 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.68 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|