C23H28FN3O2S2 — CID 25062338
N-butyl-5-fluoro-3-methyl-N-(4-piperazin-1-ylphenyl)-1-benzothiophene-2-sulfonamide (PubChem CID 25062338) has the molecular formula C23H28FN3O2S2 and a molecular weight of 461.63 g/mol. Its IUPAC name is N-butyl-5-fluoro-3-methyl-N-(4-piperazin-1-ylphenyl)-1-benzothiophene-2-sulfonamide.
| Compound Name | N-butyl-5-fluoro-3-methyl-N-(4-piperazin-1-ylphenyl)-1-benzothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 25062338 |
| Molecular Formula | C23H28FN3O2S2 |
| Molecular Weight | 461.63 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | N-butyl-5-fluoro-3-methyl-N-(4-piperazin-1-ylphenyl)-1-benzothiophene-2-sulfonamide |
| SMILES | CCCCN(c1ccc(N2CCNCC2)cc1)S(=O)(=O)c1sc2ccc(F)cc2c1C |
| InChI | InChI=1S/C23H28FN3O2S2/c1-3-4-13-27(20-8-6-19(7-9-20)26-14-11-25-12-15-26)31(28,29)23-17(2)21-16-18(24)5-10-22(21)30-23/h5-10,16,25H,3-4,11-15H2,1-2H3 |
| InChIKey | AGYQDHHCYLPRQY-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.63 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|