C22H27FN2O3S2 — CID 25065513
2-[2-[(2R)-1-[4-[(1R)-1-fluorohexyl]phenyl]-5-oxopyrrolidin-2-yl]ethylsulfanyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 25065513) has the molecular formula C22H27FN2O3S2 and a molecular weight of 450.60 g/mol. Its IUPAC name is 2-[2-[(2R)-1-[4-[(1R)-1-fluorohexyl]phenyl]-5-oxopyrrolidin-2-yl]ethylsulfanyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[2-[(2R)-1-[4-[(1R)-1-fluorohexyl]phenyl]-5-oxopyrrolidin-2-yl]ethylsulfanyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 25065513 |
| Molecular Formula | C22H27FN2O3S2 |
| Molecular Weight | 450.60 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | 2-[2-[(2R)-1-[4-[(1R)-1-fluorohexyl]phenyl]-5-oxopyrrolidin-2-yl]ethylsulfanyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | CCCCC[C@@H](F)c1ccc(N2C(=O)CC[C@@H]2CCSc2nc(C(=O)O)cs2)cc1 |
| InChI | InChI=1S/C22H27FN2O3S2/c1-2-3-4-5-18(23)15-6-8-16(9-7-15)25-17(10-11-20(25)26)12-13-29-22-24-19(14-30-22)21(27)28/h6-9,14,17-18H,2-5,10-13H2,1H3,(H,27,28)/t17-,18-/m1/s1 |
| InChIKey | NRWCXRXAQNCWNO-QZTJIDSGSA-N |
| XLogP | 6.11 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.60 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|