C21H25FN2O3S2 — CID 25066143
2-[[(2R)-1-[4-[(1R)-1-fluorohexyl]phenyl]-5-oxopyrrolidin-2-yl]methylsulfanyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 25066143) has the molecular formula C21H25FN2O3S2 and a molecular weight of 436.57 g/mol. Its IUPAC name is 2-[[(2R)-1-[4-[(1R)-1-fluorohexyl]phenyl]-5-oxopyrrolidin-2-yl]methylsulfanyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[[(2R)-1-[4-[(1R)-1-fluorohexyl]phenyl]-5-oxopyrrolidin-2-yl]methylsulfanyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 25066143 |
| Molecular Formula | C21H25FN2O3S2 |
| Molecular Weight | 436.57 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | 2-[[(2R)-1-[4-[(1R)-1-fluorohexyl]phenyl]-5-oxopyrrolidin-2-yl]methylsulfanyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | CCCCC[C@@H](F)c1ccc(N2C(=O)CC[C@@H]2CSc2nc(C(=O)O)cs2)cc1 |
| InChI | InChI=1S/C21H25FN2O3S2/c1-2-3-4-5-17(22)14-6-8-15(9-7-14)24-16(10-11-19(24)25)12-28-21-23-18(13-29-21)20(26)27/h6-9,13,16-17H,2-5,10-12H2,1H3,(H,26,27)/t16-,17-/m1/s1 |
| InChIKey | NEMDUNHXRLBRLQ-IAGOWNOFSA-N |
| XLogP | 5.72 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.57 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|