C25H24N2O4S — CID 25067037
(2S)-2-[[1-(benzenesulfonyl)indol-3-yl]-ethylamino]-3-phenylpropanoic acid (PubChem CID 25067037) has the molecular formula C25H24N2O4S and a molecular weight of 448.54 g/mol. Its IUPAC name is (2S)-2-[[1-(benzenesulfonyl)indol-3-yl]-ethylamino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[[1-(benzenesulfonyl)indol-3-yl]-ethylamino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 25067037 |
| Molecular Formula | C25H24N2O4S |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | (2S)-2-[[1-(benzenesulfonyl)indol-3-yl]-ethylamino]-3-phenylpropanoic acid |
| SMILES | CCN(c1cn(S(=O)(=O)c2ccccc2)c2ccccc12)[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C25H24N2O4S/c1-2-26(23(25(28)29)17-19-11-5-3-6-12-19)24-18-27(22-16-10-9-15-21(22)24)32(30,31)20-13-7-4-8-14-20/h3-16,18,23H,2,17H2,1H3,(H,28,29)/t23-/m0/s1 |
| InChIKey | HRJUXHGKECNBJN-QHCPKHFHSA-N |
| XLogP | 4.40 |
| TPSA | 79.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |